n-Amyl nitrate
n-Amyl nitrate
CAS: 1002-16-0
Molecular Formula: C5H11NO3
n-Amyl nitrate - Names and Identifiers
| Name | n-Amyl nitrate |
| Synonyms | Aspirols Aspirols amyl nitrate pentylnitrate pentyl nitrate nitrated'amyle n-Amyl nitrate 1-Pentyl nitrate 1-Nitrooxypentane nitricacidpentylester Nitricacid,pentylester Nitric acid amyl ester |
| CAS | 1002-16-0 |
| EINECS | 213-684-2 |
| InChI | InChI=1/C5H11NO3/c1-2-3-4-5-9-6(7)8/h2-5H2,1H3 |
n-Amyl nitrate - Physico-chemical Properties
| Molecular Formula | C5H11NO3 |
| Molar Mass | 133.15 |
| Density | 1.00 |
| Melting Point | -123.2°C |
| Boling Point | 157 °C |
| Flash Point | 52 °C |
| Water Solubility | Insoluble in water |
| Vapor Presure | 3.55mmHg at 25°C |
| Appearance | Liquid |
| Color | Colorless to Light yellow to Light orange |
| Refractive Index | 1.4120-1.4160 |
| Use | For Organic synthesis |
n-Amyl nitrate - Risk and Safety
| UN IDs | 1112 |
| RTECS | QV0600000 |
| Hazard Class | 3.1 |
| Packing Group | III |
| Toxicity | LCLo ihl-rat: 3593 ppm AMIHAB 11,290,55 |
n-Amyl nitrate - Reference Information
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | for organic synthesis |
| category | flammable liquid |
| toxicity grade | poisoning |
| Acute toxicity | inhalation-rat LCL0: 3593 PPM; Inhalation-mouse LCL0: 1374 PPM |
| explosive hazard characteristics | oxidant |
| flammability hazard characteristics | flammable in open flame, high temperature, reducing agent; toxic NOx smoke from combustion |
| storage and transportation characteristics | The package is complete, light, light; The warehouse is ventilated, away from open flame, high temperature, and oxidation, separate storage of reducing agent |
| fire extinguishing agent | foam, carbon dioxide, dry powder, sand, 1211 |
| toxic substance data | information provided by: pubchem.ncbi.nlm.nih.gov (external link) |
Last Update：2024-04-09 15:16:45
